C20H32N4O2SSi — CID 90113349
N-tert-butyl-3-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrazole-4-carboxamide (PubChem CID 90113349) has the molecular formula C20H32N4O2SSi and a molecular weight of 420.66 g/mol. Its IUPAC name is N-tert-butyl-3-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrazole-4-carboxamide.
| Compound Name | N-tert-butyl-3-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 90113349 |
| Molecular Formula | C20H32N4O2SSi |
| Molecular Weight | 420.66 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | N-tert-butyl-3-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrazole-4-carboxamide |
| SMILES | CC(C)(C)NC(=O)c1cn(COCC[Si](C)(C)C)nc1-c1nc2c(s1)CCC2 |
| InChI | InChI=1S/C20H32N4O2SSi/c1-20(2,3)22-18(25)14-12-24(13-26-10-11-28(4,5)6)23-17(14)19-21-15-8-7-9-16(15)27-19/h12H,7-11,13H2,1-6H3,(H,22,25) |
| InChIKey | UROSOKMDXLMZKL-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.66 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|