About 1,2-diethyl-3-phenylbenzene;formamide
1,2-diethyl-3-phenylbenzene;formamide (PubChem CID 90113659) has the molecular formula C17H21NO
and a molecular weight of 255.36 g/mol. Its IUPAC name is 1,2-diethyl-3-phenylbenzene;formamide.
Molecular Properties
| Compound Name | 1,2-diethyl-3-phenylbenzene;formamide |
| PubChem CID | 90113659 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 1,2-diethyl-3-phenylbenzene;formamide |
| SMILES | CCc1cccc(-c2ccccc2)c1CC.NC=O |
| InChI | InChI=1S/C16H18.CH3NO/c1-3-13-11-8-12-16(15(13)4-2)14-9-6-5-7-10-14;2-1-3/h5-12H,3-4H2,1-2H3;1H,(H2,2,3) |
| InChIKey | LDXACYGUNKCOKD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1,2-diethyl-3-phenylbenzene;formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diethyl-3-phenylbenzene;formamide?
The IUPAC name of 1,2-diethyl-3-phenylbenzene;formamide (CID 90113659) is 1,2-diethyl-3-phenylbenzene;formamide.
What is the SMILES notation for 1,2-diethyl-3-phenylbenzene;formamide?
The canonical SMILES for 1,2-diethyl-3-phenylbenzene;formamide is CCc1cccc(-c2ccccc2)c1CC.NC=O.
What is the InChIKey of 1,2-diethyl-3-phenylbenzene;formamide?
The InChIKey is LDXACYGUNKCOKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18.CH3NO/c1-3-13-11-8-12-16(15(13)4-2)14-9-6-5-7-10-14;2-1-3/h5-12H,3-4H2,1-2H3;1H,(H2,2,3).
What are the key properties of 1,2-diethyl-3-phenylbenzene;formamide?
1,2-diethyl-3-phenylbenzene;formamide has a molecular weight of 255.36 g/mol, XLogP of 3.58, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diethyl-3-phenylbenzene;formamide is sourced from PubChem (CID 90113659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).