About [6-methyl-3-(pyridin-3-ylamino)-2-pyridinyl] N-(5-methyl-1,3-thiazol-2-yl)carbamate
[6-methyl-3-(pyridin-3-ylamino)-2-pyridinyl] N-(5-methyl-1,3-thiazol-2-yl)carbamate (PubChem CID 90114025) has the molecular formula C16H15N5O2S
and a molecular weight of 341.40 g/mol. Its IUPAC name is [6-methyl-3-(pyridin-3-ylamino)-2-pyridinyl] N-(5-methyl-1,3-thiazol-2-yl)carbamate.
Molecular Properties
| Compound Name | [6-methyl-3-(pyridin-3-ylamino)-2-pyridinyl] N-(5-methyl-1,3-thiazol-2-yl)carbamate |
| PubChem CID | 90114025 |
| Molecular Formula | C16H15N5O2S |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | [6-methyl-3-(pyridin-3-ylamino)-2-pyridinyl] N-(5-methyl-1,3-thiazol-2-yl)carbamate |
| SMILES | Cc1ccc(Nc2cccnc2)c(OC(=O)Nc2ncc(C)s2)n1 |
| InChI | InChI=1S/C16H15N5O2S/c1-10-5-6-13(20-12-4-3-7-17-9-12)14(19-10)23-16(22)21-15-18-8-11(2)24-15/h3-9,20H,1-2H3,(H,18,21,22) |
| InChIKey | AZORYHOSVLYTRJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [6-methyl-3-(pyridin-3-ylamino)-2-pyridinyl] N-(5-methyl-1,3-thiazol-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-methyl-3-(pyridin-3-ylamino)-2-pyridinyl] N-(5-methyl-1,3-thiazol-2-yl)carbamate?
The IUPAC name of [6-methyl-3-(pyridin-3-ylamino)-2-pyridinyl] N-(5-methyl-1,3-thiazol-2-yl)carbamate (CID 90114025) is [6-methyl-3-(pyridin-3-ylamino)-2-pyridinyl] N-(5-methyl-1,3-thiazol-2-yl)carbamate.
What is the SMILES notation for [6-methyl-3-(pyridin-3-ylamino)-2-pyridinyl] N-(5-methyl-1,3-thiazol-2-yl)carbamate?
The canonical SMILES for [6-methyl-3-(pyridin-3-ylamino)-2-pyridinyl] N-(5-methyl-1,3-thiazol-2-yl)carbamate is Cc1ccc(Nc2cccnc2)c(OC(=O)Nc2ncc(C)s2)n1.
What is the InChIKey of [6-methyl-3-(pyridin-3-ylamino)-2-pyridinyl] N-(5-methyl-1,3-thiazol-2-yl)carbamate?
The InChIKey is AZORYHOSVLYTRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N5O2S/c1-10-5-6-13(20-12-4-3-7-17-9-12)14(19-10)23-16(22)21-15-18-8-11(2)24-15/h3-9,20H,1-2H3,(H,18,21,22).
What are the key properties of [6-methyl-3-(pyridin-3-ylamino)-2-pyridinyl] N-(5-methyl-1,3-thiazol-2-yl)carbamate?
[6-methyl-3-(pyridin-3-ylamino)-2-pyridinyl] N-(5-methyl-1,3-thiazol-2-yl)carbamate has a molecular weight of 341.40 g/mol, XLogP of 3.90, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [6-methyl-3-(pyridin-3-ylamino)-2-pyridinyl] N-(5-methyl-1,3-thiazol-2-yl)carbamate is sourced from PubChem (CID 90114025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).