C14H12ClF3N4O3 — CID 90114224
[(7R)-4-chloro-8-oxo-9-(2,2,2-trifluoroethyl)-3,6,7,10-tetrahydropyrazolo[3,4-i][2]benzazepin-7-yl]carbamic acid (PubChem CID 90114224) has the molecular formula C14H12ClF3N4O3 and a molecular weight of 376.72 g/mol. Its IUPAC name is [(7R)-4-chloro-8-oxo-9-(2,2,2-trifluoroethyl)-3,6,7,10-tetrahydropyrazolo[3,4-i][2]benzazepin-7-yl]carbamic acid.
| Compound Name | [(7R)-4-chloro-8-oxo-9-(2,2,2-trifluoroethyl)-3,6,7,10-tetrahydropyrazolo[3,4-i][2]benzazepin-7-yl]carbamic acid |
|---|---|
| PubChem CID | 90114224 |
| Molecular Formula | C14H12ClF3N4O3 |
| Molecular Weight | 376.72 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | [(7R)-4-chloro-8-oxo-9-(2,2,2-trifluoroethyl)-3,6,7,10-tetrahydropyrazolo[3,4-i][2]benzazepin-7-yl]carbamic acid |
| SMILES | O=C(O)N[C@@H]1Cc2cc(Cl)c3[nH]ncc3c2CN(CC(F)(F)F)C1=O |
| InChI | InChI=1S/C14H12ClF3N4O3/c15-9-1-6-2-10(20-13(24)25)12(23)22(5-14(16,17)18)4-8(6)7-3-19-21-11(7)9/h1,3,10,20H,2,4-5H2,(H,19,21)(H,24,25)/t10-/m1/s1 |
| InChIKey | KAKSWNSKDTZXGB-SNVBAGLBSA-N |
| XLogP | 2.30 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.72 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |