About 3-azabicyclo[4.1.0]heptan-1-amine;dihydrochloride
3-azabicyclo[4.1.0]heptan-1-amine;dihydrochloride (PubChem CID 90114299) has the molecular formula C6H14Cl2N2
and a molecular weight of 185.10 g/mol. Its IUPAC name is 3-azabicyclo[4.1.0]heptan-1-amine;dihydrochloride.
Molecular Properties
| Compound Name | 3-azabicyclo[4.1.0]heptan-1-amine;dihydrochloride |
| PubChem CID | 90114299 |
| Molecular Formula | C6H14Cl2N2 |
| Molecular Weight | 185.10 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | 3-azabicyclo[4.1.0]heptan-1-amine;dihydrochloride |
| SMILES | Cl.Cl.NC12CNCCC1C2 |
| InChI | InChI=1S/C6H12N2.2ClH/c7-6-3-5(6)1-2-8-4-6;;/h5,8H,1-4,7H2;2*1H |
| InChIKey | AVYSTUUSTBYGPE-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.10 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-azabicyclo[4.1.0]heptan-1-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-azabicyclo[4.1.0]heptan-1-amine;dihydrochloride?
The IUPAC name of 3-azabicyclo[4.1.0]heptan-1-amine;dihydrochloride (CID 90114299) is 3-azabicyclo[4.1.0]heptan-1-amine;dihydrochloride.
What is the SMILES notation for 3-azabicyclo[4.1.0]heptan-1-amine;dihydrochloride?
The canonical SMILES for 3-azabicyclo[4.1.0]heptan-1-amine;dihydrochloride is Cl.Cl.NC12CNCCC1C2.
What is the InChIKey of 3-azabicyclo[4.1.0]heptan-1-amine;dihydrochloride?
The InChIKey is AVYSTUUSTBYGPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2.2ClH/c7-6-3-5(6)1-2-8-4-6;;/h5,8H,1-4,7H2;2*1H.
What are the key properties of 3-azabicyclo[4.1.0]heptan-1-amine;dihydrochloride?
3-azabicyclo[4.1.0]heptan-1-amine;dihydrochloride has a molecular weight of 185.10 g/mol, XLogP of 0.54, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-azabicyclo[4.1.0]heptan-1-amine;dihydrochloride is sourced from PubChem (CID 90114299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).