C27H28FN5O2S — CID 90114667
4-fluoro-N-[4-[6-(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]benzenesulfonamide (PubChem CID 90114667) has the molecular formula C27H28FN5O2S and a molecular weight of 505.62 g/mol. Its IUPAC name is 4-fluoro-N-[4-[6-(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[4-[6-(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90114667 |
| Molecular Formula | C27H28FN5O2S |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | 4-fluoro-N-[4-[6-(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]benzenesulfonamide |
| SMILES | CC1(C)C=C(c2cc3c(-c4ccc(NS(=O)(=O)c5ccc(F)cc5)cc4)ncnc3[nH]2)CC(C)(C)N1 |
| InChI | InChI=1S/C27H28FN5O2S/c1-26(2)14-18(15-27(3,4)33-26)23-13-22-24(29-16-30-25(22)31-23)17-5-9-20(10-6-17)32-36(34,35)21-11-7-19(28)8-12-21/h5-14,16,32-33H,15H2,1-4H3,(H,29,30,31) |
| InChIKey | XZUFMKVARKYYFF-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |