About 2,2,2-trichloroethyl 4-oxochromene-2-carboxylate
2,2,2-trichloroethyl 4-oxochromene-2-carboxylate (PubChem CID 901150) has the molecular formula C12H7Cl3O4
and a molecular weight of 321.54 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 4-oxochromene-2-carboxylate.
Molecular Properties
| Compound Name | 2,2,2-trichloroethyl 4-oxochromene-2-carboxylate |
| PubChem CID | 901150 |
| Molecular Formula | C12H7Cl3O4 |
| Molecular Weight | 321.54 g/mol |
| Exact Mass | 319.94 |
| IUPAC Name | 2,2,2-trichloroethyl 4-oxochromene-2-carboxylate |
| SMILES | O=C(OCC(Cl)(Cl)Cl)c1cc(=O)c2ccccc2o1 |
| InChI | InChI=1S/C12H7Cl3O4/c13-12(14,15)6-18-11(17)10-5-8(16)7-3-1-2-4-9(7)19-10/h1-5H,6H2 |
| InChIKey | LAVJPCQVLWLKNW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,2,2-trichloroethyl 4-oxochromene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trichloroethyl 4-oxochromene-2-carboxylate?
The IUPAC name of 2,2,2-trichloroethyl 4-oxochromene-2-carboxylate (CID 901150) is 2,2,2-trichloroethyl 4-oxochromene-2-carboxylate.
What is the SMILES notation for 2,2,2-trichloroethyl 4-oxochromene-2-carboxylate?
The canonical SMILES for 2,2,2-trichloroethyl 4-oxochromene-2-carboxylate is O=C(OCC(Cl)(Cl)Cl)c1cc(=O)c2ccccc2o1.
What is the InChIKey of 2,2,2-trichloroethyl 4-oxochromene-2-carboxylate?
The InChIKey is LAVJPCQVLWLKNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7Cl3O4/c13-12(14,15)6-18-11(17)10-5-8(16)7-3-1-2-4-9(7)19-10/h1-5H,6H2.
What are the key properties of 2,2,2-trichloroethyl 4-oxochromene-2-carboxylate?
2,2,2-trichloroethyl 4-oxochromene-2-carboxylate has a molecular weight of 321.54 g/mol, XLogP of 3.32, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trichloroethyl 4-oxochromene-2-carboxylate is sourced from PubChem (CID 901150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).