About 3-[4-(3,5-dimethoxyphenyl)-1,3-oxazol-5-yl]-2-fluoro-6-methoxyphenol
3-[4-(3,5-dimethoxyphenyl)-1,3-oxazol-5-yl]-2-fluoro-6-methoxyphenol (PubChem CID 90115164) has the molecular formula C18H16FNO5
and a molecular weight of 345.33 g/mol. Its IUPAC name is 3-[4-(3,5-dimethoxyphenyl)-1,3-oxazol-5-yl]-2-fluoro-6-methoxyphenol.
Molecular Properties
| Compound Name | 3-[4-(3,5-dimethoxyphenyl)-1,3-oxazol-5-yl]-2-fluoro-6-methoxyphenol |
| PubChem CID | 90115164 |
| Molecular Formula | C18H16FNO5 |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 3-[4-(3,5-dimethoxyphenyl)-1,3-oxazol-5-yl]-2-fluoro-6-methoxyphenol |
| SMILES | COc1cc(OC)cc(-c2ncoc2-c2ccc(OC)c(O)c2F)c1 |
| InChI | InChI=1S/C18H16FNO5/c1-22-11-6-10(7-12(8-11)23-2)16-18(25-9-20-16)13-4-5-14(24-3)17(21)15(13)19/h4-9,21H,1-3H3 |
| InChIKey | CMVHSDLRUNEUKF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 73.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[4-(3,5-dimethoxyphenyl)-1,3-oxazol-5-yl]-2-fluoro-6-methoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(3,5-dimethoxyphenyl)-1,3-oxazol-5-yl]-2-fluoro-6-methoxyphenol?
The IUPAC name of 3-[4-(3,5-dimethoxyphenyl)-1,3-oxazol-5-yl]-2-fluoro-6-methoxyphenol (CID 90115164) is 3-[4-(3,5-dimethoxyphenyl)-1,3-oxazol-5-yl]-2-fluoro-6-methoxyphenol.
What is the SMILES notation for 3-[4-(3,5-dimethoxyphenyl)-1,3-oxazol-5-yl]-2-fluoro-6-methoxyphenol?
The canonical SMILES for 3-[4-(3,5-dimethoxyphenyl)-1,3-oxazol-5-yl]-2-fluoro-6-methoxyphenol is COc1cc(OC)cc(-c2ncoc2-c2ccc(OC)c(O)c2F)c1.
What is the InChIKey of 3-[4-(3,5-dimethoxyphenyl)-1,3-oxazol-5-yl]-2-fluoro-6-methoxyphenol?
The InChIKey is CMVHSDLRUNEUKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16FNO5/c1-22-11-6-10(7-12(8-11)23-2)16-18(25-9-20-16)13-4-5-14(24-3)17(21)15(13)19/h4-9,21H,1-3H3.
What are the key properties of 3-[4-(3,5-dimethoxyphenyl)-1,3-oxazol-5-yl]-2-fluoro-6-methoxyphenol?
3-[4-(3,5-dimethoxyphenyl)-1,3-oxazol-5-yl]-2-fluoro-6-methoxyphenol has a molecular weight of 345.33 g/mol, XLogP of 3.88, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(3,5-dimethoxyphenyl)-1,3-oxazol-5-yl]-2-fluoro-6-methoxyphenol is sourced from PubChem (CID 90115164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).