C18H22NO2+ — CID 90115374
(2S)-1-methyl-1-[(1R)-1-naphthalen-2-ylethyl]pyrrolidin-1-ium-2-carboxylic acid (PubChem CID 90115374) has the molecular formula C18H22NO2+ and a molecular weight of 284.38 g/mol. Its IUPAC name is (2S)-1-methyl-1-[(1R)-1-naphthalen-2-ylethyl]pyrrolidin-1-ium-2-carboxylic acid.
| Compound Name | (2S)-1-methyl-1-[(1R)-1-naphthalen-2-ylethyl]pyrrolidin-1-ium-2-carboxylic acid |
|---|---|
| PubChem CID | 90115374 |
| Molecular Formula | C18H22NO2+ |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | (2S)-1-methyl-1-[(1R)-1-naphthalen-2-ylethyl]pyrrolidin-1-ium-2-carboxylic acid |
| SMILES | C[C@H](c1ccc2ccccc2c1)[N+]1(C)CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C18H21NO2/c1-13(19(2)11-5-8-17(19)18(20)21)15-10-9-14-6-3-4-7-16(14)12-15/h3-4,6-7,9-10,12-13,17H,5,8,11H2,1-2H3/p+1/t13-,17+,19?/m1/s1 |
| InChIKey | MAQWLSAKAUBMPW-XHNGYCAMSA-O |
| XLogP | 3.59 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|