C9H14F5NO3 — CID 90115452
(6,6,7,7,7-pentafluoro-2-hydroxy-2-methylheptan-3-yl)carbamic acid (PubChem CID 90115452) has the molecular formula C9H14F5NO3 and a molecular weight of 279.20 g/mol. Its IUPAC name is (6,6,7,7,7-pentafluoro-2-hydroxy-2-methylheptan-3-yl)carbamic acid.
| Compound Name | (6,6,7,7,7-pentafluoro-2-hydroxy-2-methylheptan-3-yl)carbamic acid |
|---|---|
| PubChem CID | 90115452 |
| Molecular Formula | C9H14F5NO3 |
| Molecular Weight | 279.20 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | (6,6,7,7,7-pentafluoro-2-hydroxy-2-methylheptan-3-yl)carbamic acid |
| SMILES | CC(C)(O)C(CCC(F)(F)C(F)(F)F)NC(=O)O |
| InChI | InChI=1S/C9H14F5NO3/c1-7(2,18)5(15-6(16)17)3-4-8(10,11)9(12,13)14/h5,15,18H,3-4H2,1-2H3,(H,16,17) |
| InChIKey | DLYRNIXQYQZKLV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.20 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|