C12H15BO6 — CID 90115813
(1S,7R,8R,9R)-7-(hydroxymethyl)-3-phenyl-2,4,6-trioxa-3-borabicyclo[3.2.2]nonane-8,9-diol (PubChem CID 90115813) has the molecular formula C12H15BO6 and a molecular weight of 266.06 g/mol. Its IUPAC name is (1S,7R,8R,9R)-7-(hydroxymethyl)-3-phenyl-2,4,6-trioxa-3-borabicyclo[3.2.2]nonane-8,9-diol.
| Compound Name | (1S,7R,8R,9R)-7-(hydroxymethyl)-3-phenyl-2,4,6-trioxa-3-borabicyclo[3.2.2]nonane-8,9-diol |
|---|---|
| PubChem CID | 90115813 |
| Molecular Formula | C12H15BO6 |
| Molecular Weight | 266.06 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | (1S,7R,8R,9R)-7-(hydroxymethyl)-3-phenyl-2,4,6-trioxa-3-borabicyclo[3.2.2]nonane-8,9-diol |
| SMILES | OC[C@H]1OC2OB(c3ccccc3)O[C@H]1[C@H](O)[C@H]2O |
| InChI | InChI=1S/C12H15BO6/c14-6-8-11-9(15)10(16)12(17-8)19-13(18-11)7-4-2-1-3-5-7/h1-5,8-12,14-16H,6H2/t8-,9-,10-,11-,12?/m1/s1 |
| InChIKey | GAEZADZUHNNLLL-PRFVCTMUSA-N |
| XLogP | -1.76 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.06 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|