C10H16F5NO3 — CID 90115896
(7,7,8,8,8-pentafluoro-2-hydroxy-2-methyloctan-3-yl)carbamic acid (PubChem CID 90115896) has the molecular formula C10H16F5NO3 and a molecular weight of 293.23 g/mol. Its IUPAC name is (7,7,8,8,8-pentafluoro-2-hydroxy-2-methyloctan-3-yl)carbamic acid.
| Compound Name | (7,7,8,8,8-pentafluoro-2-hydroxy-2-methyloctan-3-yl)carbamic acid |
|---|---|
| PubChem CID | 90115896 |
| Molecular Formula | C10H16F5NO3 |
| Molecular Weight | 293.23 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | (7,7,8,8,8-pentafluoro-2-hydroxy-2-methyloctan-3-yl)carbamic acid |
| SMILES | CC(C)(O)C(CCCC(F)(F)C(F)(F)F)NC(=O)O |
| InChI | InChI=1S/C10H16F5NO3/c1-8(2,19)6(16-7(17)18)4-3-5-9(11,12)10(13,14)15/h6,16,19H,3-5H2,1-2H3,(H,17,18) |
| InChIKey | AEVCEMVNPBHDLN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.23 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|