C18H20F2N2O6S — CID 90116105
(2R)-4-[4-[4-(difluoromethoxy)phenyl]-2-oxo-1-pyridinyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide (PubChem CID 90116105) has the molecular formula C18H20F2N2O6S and a molecular weight of 430.43 g/mol. Its IUPAC name is (2R)-4-[4-[4-(difluoromethoxy)phenyl]-2-oxo-1-pyridinyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | (2R)-4-[4-[4-(difluoromethoxy)phenyl]-2-oxo-1-pyridinyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 90116105 |
| Molecular Formula | C18H20F2N2O6S |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | (2R)-4-[4-[4-(difluoromethoxy)phenyl]-2-oxo-1-pyridinyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
| SMILES | C[C@@](CCn1ccc(-c2ccc(OC(F)F)cc2)cc1=O)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C18H20F2N2O6S/c1-18(16(24)21-25,29(2,26)27)8-10-22-9-7-13(11-15(22)23)12-3-5-14(6-4-12)28-17(19)20/h3-7,9,11,17,25H,8,10H2,1-2H3,(H,21,24)/t18-/m1/s1 |
| InChIKey | YFYHNVDSWUHOJY-GOSISDBHSA-N |
| XLogP | 1.82 |
| TPSA | 114.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|