C30H40ClN5O5S2 — CID 90116178
5-chloro-2-[4-(1-ethylsulfonylpiperidin-4-yl)-2,5-dimethyl-2,3-dihydro-1-benzofuran-7-yl]-4-(2-propan-2-ylsulfonylphenyl)pyrimidine;hydrazine (PubChem CID 90116178) has the molecular formula C30H40ClN5O5S2 and a molecular weight of 650.27 g/mol. Its IUPAC name is 5-chloro-2-[4-(1-ethylsulfonylpiperidin-4-yl)-2,5-dimethyl-2,3-dihydro-1-benzofuran-7-yl]-4-(2-propan-2-ylsulfonylphenyl)pyrimidine;hydrazine.
| Compound Name | 5-chloro-2-[4-(1-ethylsulfonylpiperidin-4-yl)-2,5-dimethyl-2,3-dihydro-1-benzofuran-7-yl]-4-(2-propan-2-ylsulfonylphenyl)pyrimidine;hydrazine |
|---|---|
| PubChem CID | 90116178 |
| Molecular Formula | C30H40ClN5O5S2 |
| Molecular Weight | 650.27 g/mol |
| Exact Mass | 649.22 |
| IUPAC Name | 5-chloro-2-[4-(1-ethylsulfonylpiperidin-4-yl)-2,5-dimethyl-2,3-dihydro-1-benzofuran-7-yl]-4-(2-propan-2-ylsulfonylphenyl)pyrimidine;hydrazine |
| SMILES | CCS(=O)(=O)N1CCC(c2c(C)cc(-c3ncc(Cl)c(-c4ccccc4S(=O)(=O)C(C)C)n3)c3c2CC(C)O3)CC1.NN |
| InChI | InChI=1S/C30H36ClN3O5S2.H4N2/c1-6-40(35,36)34-13-11-21(12-14-34)27-19(4)15-24(29-23(27)16-20(5)39-29)30-32-17-25(31)28(33-30)22-9-7-8-10-26(22)41(37,38)18(2)3;1-2/h7-10,15,17-18,20-21H,6,11-14,16H2,1-5H3;1-2H2 |
| InChIKey | NILBTCOBARAHKZ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 158.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.27 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|