C19H21N3O6S2 — CID 90116412
(2R)-N-hydroxy-2-methyl-4-[4-(3-methyl-2-oxo-1,3-benzothiazol-6-yl)-2-oxo-1-pyridinyl]-2-methylsulfonylbutanamide (PubChem CID 90116412) has the molecular formula C19H21N3O6S2 and a molecular weight of 451.53 g/mol. Its IUPAC name is (2R)-N-hydroxy-2-methyl-4-[4-(3-methyl-2-oxo-1,3-benzothiazol-6-yl)-2-oxo-1-pyridinyl]-2-methylsulfonylbutanamide.
| Compound Name | (2R)-N-hydroxy-2-methyl-4-[4-(3-methyl-2-oxo-1,3-benzothiazol-6-yl)-2-oxo-1-pyridinyl]-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 90116412 |
| Molecular Formula | C19H21N3O6S2 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | (2R)-N-hydroxy-2-methyl-4-[4-(3-methyl-2-oxo-1,3-benzothiazol-6-yl)-2-oxo-1-pyridinyl]-2-methylsulfonylbutanamide |
| SMILES | Cn1c(=O)sc2cc(-c3ccn(CC[C@](C)(C(=O)NO)S(C)(=O)=O)c(=O)c3)ccc21 |
| InChI | InChI=1S/C19H21N3O6S2/c1-19(17(24)20-26,30(3,27)28)7-9-22-8-6-13(11-16(22)23)12-4-5-14-15(10-12)29-18(25)21(14)2/h4-6,8,10-11,26H,7,9H2,1-3H3,(H,20,24)/t19-/m1/s1 |
| InChIKey | BHZOXKZOBYJMLW-LJQANCHMSA-N |
| XLogP | 1.13 |
| TPSA | 127.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|