C19H23N3O6S — CID 90116562
4-[1-[4-(hydroxyamino)-3-methyl-3-methylsulfonyl-4-oxobutyl]-2-oxo-4-pyridinyl]-3-methylbenzamide (PubChem CID 90116562) has the molecular formula C19H23N3O6S and a molecular weight of 421.48 g/mol. Its IUPAC name is 4-[1-[4-(hydroxyamino)-3-methyl-3-methylsulfonyl-4-oxobutyl]-2-oxo-4-pyridinyl]-3-methylbenzamide.
| Compound Name | 4-[1-[4-(hydroxyamino)-3-methyl-3-methylsulfonyl-4-oxobutyl]-2-oxo-4-pyridinyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 90116562 |
| Molecular Formula | C19H23N3O6S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 4-[1-[4-(hydroxyamino)-3-methyl-3-methylsulfonyl-4-oxobutyl]-2-oxo-4-pyridinyl]-3-methylbenzamide |
| SMILES | Cc1cc(C(N)=O)ccc1-c1ccn(CCC(C)(C(=O)NO)S(C)(=O)=O)c(=O)c1 |
| InChI | InChI=1S/C19H23N3O6S/c1-12-10-14(17(20)24)4-5-15(12)13-6-8-22(16(23)11-13)9-7-19(2,18(25)21-26)29(3,27)28/h4-6,8,10-11,26H,7,9H2,1-3H3,(H2,20,24)(H,21,25) |
| InChIKey | YWUMMDIOSMKPDZ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 148.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|