C22H22FN3O4 — CID 90117232
2-[(3aR,9aR)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]quinolin-9-yl]-2-amino-5-(6-fluoro-3-pyridinyl)-4,5-dioxopentanoic acid (PubChem CID 90117232) has the molecular formula C22H22FN3O4 and a molecular weight of 411.43 g/mol. Its IUPAC name is 2-[(3aR,9aR)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]quinolin-9-yl]-2-amino-5-(6-fluoro-3-pyridinyl)-4,5-dioxopentanoic acid.
| Compound Name | 2-[(3aR,9aR)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]quinolin-9-yl]-2-amino-5-(6-fluoro-3-pyridinyl)-4,5-dioxopentanoic acid |
|---|---|
| PubChem CID | 90117232 |
| Molecular Formula | C22H22FN3O4 |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 2-[(3aR,9aR)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]quinolin-9-yl]-2-amino-5-(6-fluoro-3-pyridinyl)-4,5-dioxopentanoic acid |
| SMILES | NC(CC(=O)C(=O)c1ccc(F)nc1)(C(=O)O)C1c2ccccc2N[C@@H]2CCC[C@H]12 |
| InChI | InChI=1S/C22H22FN3O4/c23-18-9-8-12(11-25-18)20(28)17(27)10-22(24,21(29)30)19-13-4-1-2-6-15(13)26-16-7-3-5-14(16)19/h1-2,4,6,8-9,11,14,16,19,26H,3,5,7,10,24H2,(H,29,30)/t14-,16+,19?,22?/m0/s1 |
| InChIKey | YTFIQSBYHMXULT-SNVCGVOLSA-N |
| XLogP | 2.52 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|