C24H23F3N2O5 — CID 90117234
2-[(3aR,9aR)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]quinolin-9-yl]-2-amino-4,5-dioxo-5-[2-(trifluoromethoxy)phenyl]pentanoic acid (PubChem CID 90117234) has the molecular formula C24H23F3N2O5 and a molecular weight of 476.45 g/mol. Its IUPAC name is 2-[(3aR,9aR)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]quinolin-9-yl]-2-amino-4,5-dioxo-5-[2-(trifluoromethoxy)phenyl]pentanoic acid.
| Compound Name | 2-[(3aR,9aR)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]quinolin-9-yl]-2-amino-4,5-dioxo-5-[2-(trifluoromethoxy)phenyl]pentanoic acid |
|---|---|
| PubChem CID | 90117234 |
| Molecular Formula | C24H23F3N2O5 |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 2-[(3aR,9aR)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]quinolin-9-yl]-2-amino-4,5-dioxo-5-[2-(trifluoromethoxy)phenyl]pentanoic acid |
| SMILES | NC(CC(=O)C(=O)c1ccccc1OC(F)(F)F)(C(=O)O)C1c2ccccc2N[C@@H]2CCC[C@H]12 |
| InChI | InChI=1S/C24H23F3N2O5/c25-24(26,27)34-19-11-4-2-7-15(19)21(31)18(30)12-23(28,22(32)33)20-13-6-1-3-9-16(13)29-17-10-5-8-14(17)20/h1-4,6-7,9,11,14,17,20,29H,5,8,10,12,28H2,(H,32,33)/t14-,17+,20?,23?/m0/s1 |
| InChIKey | NUZKAPQTOSVIMJ-UQZCCMAUSA-N |
| XLogP | 3.89 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|