C25H28N2O4 — CID 90117323
2-(2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]quinolin-9-yl)-2-amino-4,5-dioxo-7-phenylheptanoic acid (PubChem CID 90117323) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is 2-(2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]quinolin-9-yl)-2-amino-4,5-dioxo-7-phenylheptanoic acid.
| Compound Name | 2-(2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]quinolin-9-yl)-2-amino-4,5-dioxo-7-phenylheptanoic acid |
|---|---|
| PubChem CID | 90117323 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 2-(2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]quinolin-9-yl)-2-amino-4,5-dioxo-7-phenylheptanoic acid |
| SMILES | NC(CC(=O)C(=O)CCc1ccccc1)(C(=O)O)C1c2ccccc2NC2CCCC21 |
| InChI | InChI=1S/C25H28N2O4/c26-25(24(30)31,15-22(29)21(28)14-13-16-7-2-1-3-8-16)23-17-9-4-5-11-19(17)27-20-12-6-10-18(20)23/h1-5,7-9,11,18,20,23,27H,6,10,12-15,26H2,(H,30,31) |
| InChIKey | MDSALBJVHDFWCB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|