C6H10O8 — CID 90117374
(5R)-5-[(1S)-1,2-dihydroxyethyl]oxolane-2,3,4-trione;dihydrate (PubChem CID 90117374) has the molecular formula C6H10O8 and a molecular weight of 210.14 g/mol. Its IUPAC name is (5R)-5-[(1S)-1,2-dihydroxyethyl]oxolane-2,3,4-trione;dihydrate.
| Compound Name | (5R)-5-[(1S)-1,2-dihydroxyethyl]oxolane-2,3,4-trione;dihydrate |
|---|---|
| PubChem CID | 90117374 |
| Molecular Formula | C6H10O8 |
| Molecular Weight | 210.14 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | (5R)-5-[(1S)-1,2-dihydroxyethyl]oxolane-2,3,4-trione;dihydrate |
| SMILES | O.O.O=C1O[C@H]([C@@H](O)CO)C(=O)C1=O |
| InChI | InChI=1S/C6H6O6.2H2O/c7-1-2(8)5-3(9)4(10)6(11)12-5;;/h2,5,7-8H,1H2;2*1H2/t2-,5+;;/m0../s1 |
| InChIKey | PHSSIASEQDCRDM-PQYRJTSOSA-N |
| XLogP | -4.25 |
| TPSA | 163.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.14 |
| LogP ≤ 5 | -4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|