About 2-[[6,7-dimethoxy-1-(methoxymethyl)isoquinolin-4-yl]methyl]quinolin-8-ol
2-[[6,7-dimethoxy-1-(methoxymethyl)isoquinolin-4-yl]methyl]quinolin-8-ol (PubChem CID 90117708) has the molecular formula C23H22N2O4
and a molecular weight of 390.44 g/mol. Its IUPAC name is 2-[[6,7-dimethoxy-1-(methoxymethyl)isoquinolin-4-yl]methyl]quinolin-8-ol.
Molecular Properties
| Compound Name | 2-[[6,7-dimethoxy-1-(methoxymethyl)isoquinolin-4-yl]methyl]quinolin-8-ol |
| PubChem CID | 90117708 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 2-[[6,7-dimethoxy-1-(methoxymethyl)isoquinolin-4-yl]methyl]quinolin-8-ol |
| SMILES | COCc1ncc(Cc2ccc3cccc(O)c3n2)c2cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C23H22N2O4/c1-27-13-19-18-11-22(29-3)21(28-2)10-17(18)15(12-24-19)9-16-8-7-14-5-4-6-20(26)23(14)25-16/h4-8,10-12,26H,9,13H2,1-3H3 |
| InChIKey | DSGBLCCLXGAZQS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 73.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[6,7-dimethoxy-1-(methoxymethyl)isoquinolin-4-yl]methyl]quinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[6,7-dimethoxy-1-(methoxymethyl)isoquinolin-4-yl]methyl]quinolin-8-ol?
The IUPAC name of 2-[[6,7-dimethoxy-1-(methoxymethyl)isoquinolin-4-yl]methyl]quinolin-8-ol (CID 90117708) is 2-[[6,7-dimethoxy-1-(methoxymethyl)isoquinolin-4-yl]methyl]quinolin-8-ol.
What is the SMILES notation for 2-[[6,7-dimethoxy-1-(methoxymethyl)isoquinolin-4-yl]methyl]quinolin-8-ol?
The canonical SMILES for 2-[[6,7-dimethoxy-1-(methoxymethyl)isoquinolin-4-yl]methyl]quinolin-8-ol is COCc1ncc(Cc2ccc3cccc(O)c3n2)c2cc(OC)c(OC)cc12.
What is the InChIKey of 2-[[6,7-dimethoxy-1-(methoxymethyl)isoquinolin-4-yl]methyl]quinolin-8-ol?
The InChIKey is DSGBLCCLXGAZQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N2O4/c1-27-13-19-18-11-22(29-3)21(28-2)10-17(18)15(12-24-19)9-16-8-7-14-5-4-6-20(26)23(14)25-16/h4-8,10-12,26H,9,13H2,1-3H3.
What are the key properties of 2-[[6,7-dimethoxy-1-(methoxymethyl)isoquinolin-4-yl]methyl]quinolin-8-ol?
2-[[6,7-dimethoxy-1-(methoxymethyl)isoquinolin-4-yl]methyl]quinolin-8-ol has a molecular weight of 390.44 g/mol, XLogP of 4.24, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[6,7-dimethoxy-1-(methoxymethyl)isoquinolin-4-yl]methyl]quinolin-8-ol is sourced from PubChem (CID 90117708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).