About 2-[(6,7-dimethoxyisoquinolin-4-yl)methyl]quinolin-8-amine
2-[(6,7-dimethoxyisoquinolin-4-yl)methyl]quinolin-8-amine (PubChem CID 90117855) has the molecular formula C21H19N3O2
and a molecular weight of 345.40 g/mol. Its IUPAC name is 2-[(6,7-dimethoxyisoquinolin-4-yl)methyl]quinolin-8-amine.
Molecular Properties
| Compound Name | 2-[(6,7-dimethoxyisoquinolin-4-yl)methyl]quinolin-8-amine |
| PubChem CID | 90117855 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 2-[(6,7-dimethoxyisoquinolin-4-yl)methyl]quinolin-8-amine |
| SMILES | COc1cc2cncc(Cc3ccc4cccc(N)c4n3)c2cc1OC |
| InChI | InChI=1S/C21H19N3O2/c1-25-19-9-15-12-23-11-14(17(15)10-20(19)26-2)8-16-7-6-13-4-3-5-18(22)21(13)24-16/h3-7,9-12H,8,22H2,1-2H3 |
| InChIKey | IMGHCWNIUHZSGH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[(6,7-dimethoxyisoquinolin-4-yl)methyl]quinolin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6,7-dimethoxyisoquinolin-4-yl)methyl]quinolin-8-amine?
The IUPAC name of 2-[(6,7-dimethoxyisoquinolin-4-yl)methyl]quinolin-8-amine (CID 90117855) is 2-[(6,7-dimethoxyisoquinolin-4-yl)methyl]quinolin-8-amine.
What is the SMILES notation for 2-[(6,7-dimethoxyisoquinolin-4-yl)methyl]quinolin-8-amine?
The canonical SMILES for 2-[(6,7-dimethoxyisoquinolin-4-yl)methyl]quinolin-8-amine is COc1cc2cncc(Cc3ccc4cccc(N)c4n3)c2cc1OC.
What is the InChIKey of 2-[(6,7-dimethoxyisoquinolin-4-yl)methyl]quinolin-8-amine?
The InChIKey is IMGHCWNIUHZSGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N3O2/c1-25-19-9-15-12-23-11-14(17(15)10-20(19)26-2)8-16-7-6-13-4-3-5-18(22)21(13)24-16/h3-7,9-12H,8,22H2,1-2H3.
What are the key properties of 2-[(6,7-dimethoxyisoquinolin-4-yl)methyl]quinolin-8-amine?
2-[(6,7-dimethoxyisoquinolin-4-yl)methyl]quinolin-8-amine has a molecular weight of 345.40 g/mol, XLogP of 3.97, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6,7-dimethoxyisoquinolin-4-yl)methyl]quinolin-8-amine is sourced from PubChem (CID 90117855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).