methyl 2-methyl-1,3-thiazolidine-5-carboxylate

C6H11NO2S — CID 90117907

IUPACmethyl 2-methyl-1,3-thiazolidine-5-carboxylate
SMILESCOC(=O)C1CNC(C)S1
InChIInChI=1S/C6H11NO2S/c1-4-7-3-5(10-4)6(8)9-2/h4-5,7H,3H2,1-2H3
InChIKeyOFESLYPJPRCEGG-UHFFFAOYSA-N
MW161.23 g/mol
LogP0.21
Rot. Bonds1

About methyl 2-methyl-1,3-thiazolidine-5-carboxylate

methyl 2-methyl-1,3-thiazolidine-5-carboxylate (PubChem CID 90117907) has the molecular formula C6H11NO2S and a molecular weight of 161.23 g/mol. Its IUPAC name is methyl 2-methyl-1,3-thiazolidine-5-carboxylate.

Molecular Properties

Compound Namemethyl 2-methyl-1,3-thiazolidine-5-carboxylate
PubChem CID90117907
Molecular FormulaC6H11NO2S
Molecular Weight161.23 g/mol
Exact Mass161.05
IUPAC Namemethyl 2-methyl-1,3-thiazolidine-5-carboxylate
SMILESCOC(=O)C1CNC(C)S1
InChIInChI=1S/C6H11NO2S/c1-4-7-3-5(10-4)6(8)9-2/h4-5,7H,3H2,1-2H3
InChIKeyOFESLYPJPRCEGG-UHFFFAOYSA-N
XLogP0.21
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500161.23
LogP ≤ 50.21
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 2-methyl-1,3-thiazolidine-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-methyl-1,3-thiazolidine-5-carboxylate?
The IUPAC name of methyl 2-methyl-1,3-thiazolidine-5-carboxylate (CID 90117907) is methyl 2-methyl-1,3-thiazolidine-5-carboxylate.
What is the SMILES notation for methyl 2-methyl-1,3-thiazolidine-5-carboxylate?
The canonical SMILES for methyl 2-methyl-1,3-thiazolidine-5-carboxylate is COC(=O)C1CNC(C)S1.
What is the InChIKey of methyl 2-methyl-1,3-thiazolidine-5-carboxylate?
The InChIKey is OFESLYPJPRCEGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2S/c1-4-7-3-5(10-4)6(8)9-2/h4-5,7H,3H2,1-2H3.
What are the key properties of methyl 2-methyl-1,3-thiazolidine-5-carboxylate?
methyl 2-methyl-1,3-thiazolidine-5-carboxylate has a molecular weight of 161.23 g/mol, XLogP of 0.21, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methyl-1,3-thiazolidine-5-carboxylate is sourced from PubChem (CID 90117907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).