About [5-(2,2-difluoropropoxy)-4-methyl-2-pyridinyl]methanamine;hydrochloride
[5-(2,2-difluoropropoxy)-4-methyl-2-pyridinyl]methanamine;hydrochloride (PubChem CID 90118862) has the molecular formula C10H15ClF2N2O
and a molecular weight of 252.69 g/mol. Its IUPAC name is [5-(2,2-difluoropropoxy)-4-methyl-2-pyridinyl]methanamine;hydrochloride.
Molecular Properties
| Compound Name | [5-(2,2-difluoropropoxy)-4-methyl-2-pyridinyl]methanamine;hydrochloride |
| PubChem CID | 90118862 |
| Molecular Formula | C10H15ClF2N2O |
| Molecular Weight | 252.69 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | [5-(2,2-difluoropropoxy)-4-methyl-2-pyridinyl]methanamine;hydrochloride |
| SMILES | Cc1cc(CN)ncc1OCC(C)(F)F.Cl |
| InChI | InChI=1S/C10H14F2N2O.ClH/c1-7-3-8(4-13)14-5-9(7)15-6-10(2,11)12;/h3,5H,4,6,13H2,1-2H3;1H |
| InChIKey | HNGOHNLTFDZEQE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.69 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [5-(2,2-difluoropropoxy)-4-methyl-2-pyridinyl]methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2,2-difluoropropoxy)-4-methyl-2-pyridinyl]methanamine;hydrochloride?
The IUPAC name of [5-(2,2-difluoropropoxy)-4-methyl-2-pyridinyl]methanamine;hydrochloride (CID 90118862) is [5-(2,2-difluoropropoxy)-4-methyl-2-pyridinyl]methanamine;hydrochloride.
What is the SMILES notation for [5-(2,2-difluoropropoxy)-4-methyl-2-pyridinyl]methanamine;hydrochloride?
The canonical SMILES for [5-(2,2-difluoropropoxy)-4-methyl-2-pyridinyl]methanamine;hydrochloride is Cc1cc(CN)ncc1OCC(C)(F)F.Cl.
What is the InChIKey of [5-(2,2-difluoropropoxy)-4-methyl-2-pyridinyl]methanamine;hydrochloride?
The InChIKey is HNGOHNLTFDZEQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F2N2O.ClH/c1-7-3-8(4-13)14-5-9(7)15-6-10(2,11)12;/h3,5H,4,6,13H2,1-2H3;1H.
What are the key properties of [5-(2,2-difluoropropoxy)-4-methyl-2-pyridinyl]methanamine;hydrochloride?
[5-(2,2-difluoropropoxy)-4-methyl-2-pyridinyl]methanamine;hydrochloride has a molecular weight of 252.69 g/mol, XLogP of 2.30, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2,2-difluoropropoxy)-4-methyl-2-pyridinyl]methanamine;hydrochloride is sourced from PubChem (CID 90118862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).