C23H22F2N6O2 — CID 90119006
5-amino-1-[(3R,6S)-1-cyano-6-methylpiperidin-3-yl]-3-[4-(2,4-difluorophenoxy)phenyl]pyrazole-4-carboxamide (PubChem CID 90119006) has the molecular formula C23H22F2N6O2 and a molecular weight of 452.47 g/mol. Its IUPAC name is 5-amino-1-[(3R,6S)-1-cyano-6-methylpiperidin-3-yl]-3-[4-(2,4-difluorophenoxy)phenyl]pyrazole-4-carboxamide.
| Compound Name | 5-amino-1-[(3R,6S)-1-cyano-6-methylpiperidin-3-yl]-3-[4-(2,4-difluorophenoxy)phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 90119006 |
| Molecular Formula | C23H22F2N6O2 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 5-amino-1-[(3R,6S)-1-cyano-6-methylpiperidin-3-yl]-3-[4-(2,4-difluorophenoxy)phenyl]pyrazole-4-carboxamide |
| SMILES | C[C@H]1CC[C@@H](n2nc(-c3ccc(Oc4ccc(F)cc4F)cc3)c(C(N)=O)c2N)CN1C#N |
| InChI | InChI=1S/C23H22F2N6O2/c1-13-2-6-16(11-30(13)12-26)31-22(27)20(23(28)32)21(29-31)14-3-7-17(8-4-14)33-19-9-5-15(24)10-18(19)25/h3-5,7-10,13,16H,2,6,11,27H2,1H3,(H2,28,32)/t13-,16+/m0/s1 |
| InChIKey | QVXSDVJDDVFLEM-XJKSGUPXSA-N |
| XLogP | 3.81 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|