C20H14FN3O3 — CID 9011901
(2R)-3-(4-fluorophenyl)-2-(2-nitrophenyl)-1,2-dihydroquinazolin-4-one (PubChem CID 9011901) has the molecular formula C20H14FN3O3 and a molecular weight of 363.35 g/mol. Its IUPAC name is (2R)-3-(4-fluorophenyl)-2-(2-nitrophenyl)-1,2-dihydroquinazolin-4-one.
| Compound Name | (2R)-3-(4-fluorophenyl)-2-(2-nitrophenyl)-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 9011901 |
| Molecular Formula | C20H14FN3O3 |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | (2R)-3-(4-fluorophenyl)-2-(2-nitrophenyl)-1,2-dihydroquinazolin-4-one |
| SMILES | O=C1c2ccccc2N[C@@H](c2ccccc2[N+](=O)[O-])N1c1ccc(F)cc1 |
| InChI | InChI=1S/C20H14FN3O3/c21-13-9-11-14(12-10-13)23-19(16-6-2-4-8-18(16)24(26)27)22-17-7-3-1-5-15(17)20(23)25/h1-12,19,22H/t19-/m1/s1 |
| InChIKey | ZSRWAZYUXSFJCQ-LJQANCHMSA-N |
| XLogP | 4.51 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|