C25H25F2N5O3 — CID 90119070
5-amino-3-[4-(2,4-difluorophenoxy)phenyl]-1-[(3R)-1-(2-methylprop-2-enoyl)piperidin-3-yl]pyrazole-4-carboxamide (PubChem CID 90119070) has the molecular formula C25H25F2N5O3 and a molecular weight of 481.50 g/mol. Its IUPAC name is 5-amino-3-[4-(2,4-difluorophenoxy)phenyl]-1-[(3R)-1-(2-methylprop-2-enoyl)piperidin-3-yl]pyrazole-4-carboxamide.
| Compound Name | 5-amino-3-[4-(2,4-difluorophenoxy)phenyl]-1-[(3R)-1-(2-methylprop-2-enoyl)piperidin-3-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 90119070 |
| Molecular Formula | C25H25F2N5O3 |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | 5-amino-3-[4-(2,4-difluorophenoxy)phenyl]-1-[(3R)-1-(2-methylprop-2-enoyl)piperidin-3-yl]pyrazole-4-carboxamide |
| SMILES | C=C(C)C(=O)N1CCC[C@@H](n2nc(-c3ccc(Oc4ccc(F)cc4F)cc3)c(C(N)=O)c2N)C1 |
| InChI | InChI=1S/C25H25F2N5O3/c1-14(2)25(34)31-11-3-4-17(13-31)32-23(28)21(24(29)33)22(30-32)15-5-8-18(9-6-15)35-20-10-7-16(26)12-19(20)27/h5-10,12,17H,1,3-4,11,13,28H2,2H3,(H2,29,33)/t17-/m1/s1 |
| InChIKey | CFJSVUCVZRJFRO-QGZVFWFLSA-N |
| XLogP | 4.04 |
| TPSA | 116.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|