C22H27F3N2O3S — CID 90119376
(2S,5S)-2,5-dibenzyl-1-methyl-4-aza-1-azoniabicyclo[2.2.2]octane;trifluoromethanesulfonate (PubChem CID 90119376) has the molecular formula C22H27F3N2O3S and a molecular weight of 456.53 g/mol. Its IUPAC name is (2S,5S)-2,5-dibenzyl-1-methyl-4-aza-1-azoniabicyclo[2.2.2]octane;trifluoromethanesulfonate.
| Compound Name | (2S,5S)-2,5-dibenzyl-1-methyl-4-aza-1-azoniabicyclo[2.2.2]octane;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 90119376 |
| Molecular Formula | C22H27F3N2O3S |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | (2S,5S)-2,5-dibenzyl-1-methyl-4-aza-1-azoniabicyclo[2.2.2]octane;trifluoromethanesulfonate |
| SMILES | C[N+]12CCN(C[C@@H]1Cc1ccccc1)[C@@H](Cc1ccccc1)C2.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C21H27N2.CHF3O3S/c1-23-13-12-22(16-21(23)15-19-10-6-3-7-11-19)20(17-23)14-18-8-4-2-5-9-18;2-1(3,4)8(5,6)7/h2-11,20-21H,12-17H2,1H3;(H,5,6,7)/q+1;/p-1/t20-,21-,23?;/m0./s1 |
| InChIKey | UDIHEKINSXVJDF-FHSMYXGISA-M |
| XLogP | 3.04 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|