About (E)-N,N'-bis(oxolan-2-ylmethyl)but-2-ene-1,4-diamine
(E)-N,N'-bis(oxolan-2-ylmethyl)but-2-ene-1,4-diamine (PubChem CID 90119764) has the molecular formula C14H26N2O2
and a molecular weight of 254.37 g/mol. Its IUPAC name is (E)-N,N'-bis(oxolan-2-ylmethyl)but-2-ene-1,4-diamine.
Molecular Properties
| Compound Name | (E)-N,N'-bis(oxolan-2-ylmethyl)but-2-ene-1,4-diamine |
| PubChem CID | 90119764 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | (E)-N,N'-bis(oxolan-2-ylmethyl)but-2-ene-1,4-diamine |
| SMILES | C(=C/CNCC1CCCO1)\CNCC1CCCO1 |
| InChI | InChI=1S/C14H26N2O2/c1(7-15-11-13-5-3-9-17-13)2-8-16-12-14-6-4-10-18-14/h1-2,13-16H,3-12H2/b2-1+ |
| InChIKey | KYZSFWJMRZIGTI-OWOJBTEDSA-N |
| XLogP | 1.08 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-N,N'-bis(oxolan-2-ylmethyl)but-2-ene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N,N'-bis(oxolan-2-ylmethyl)but-2-ene-1,4-diamine?
The IUPAC name of (E)-N,N'-bis(oxolan-2-ylmethyl)but-2-ene-1,4-diamine (CID 90119764) is (E)-N,N'-bis(oxolan-2-ylmethyl)but-2-ene-1,4-diamine.
What is the SMILES notation for (E)-N,N'-bis(oxolan-2-ylmethyl)but-2-ene-1,4-diamine?
The canonical SMILES for (E)-N,N'-bis(oxolan-2-ylmethyl)but-2-ene-1,4-diamine is C(=C/CNCC1CCCO1)\CNCC1CCCO1.
What is the InChIKey of (E)-N,N'-bis(oxolan-2-ylmethyl)but-2-ene-1,4-diamine?
The InChIKey is KYZSFWJMRZIGTI-OWOJBTEDSA-N. The full InChI is InChI=1S/C14H26N2O2/c1(7-15-11-13-5-3-9-17-13)2-8-16-12-14-6-4-10-18-14/h1-2,13-16H,3-12H2/b2-1+.
What are the key properties of (E)-N,N'-bis(oxolan-2-ylmethyl)but-2-ene-1,4-diamine?
(E)-N,N'-bis(oxolan-2-ylmethyl)but-2-ene-1,4-diamine has a molecular weight of 254.37 g/mol, XLogP of 1.08, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N,N'-bis(oxolan-2-ylmethyl)but-2-ene-1,4-diamine is sourced from PubChem (CID 90119764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).