C13H26N2O3 — CID 90119922
1,1-bis(oxolan-2-ylmethylamino)propan-2-ol (PubChem CID 90119922) has the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. Its IUPAC name is 1,1-bis(oxolan-2-ylmethylamino)propan-2-ol.
| Compound Name | 1,1-bis(oxolan-2-ylmethylamino)propan-2-ol |
|---|---|
| PubChem CID | 90119922 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | 1,1-bis(oxolan-2-ylmethylamino)propan-2-ol |
| SMILES | CC(O)C(NCC1CCCO1)NCC1CCCO1 |
| InChI | InChI=1S/C13H26N2O3/c1-10(16)13(14-8-11-4-2-6-17-11)15-9-12-5-3-7-18-12/h10-16H,2-9H2,1H3 |
| InChIKey | UKJJDVXRBIYHSM-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|