C5H8N4S — CID 90120156
2,3,4,7-tetrahydro-1H-purine-6-thiol (PubChem CID 90120156) has the molecular formula C5H8N4S and a molecular weight of 156.21 g/mol. Its IUPAC name is 2,3,4,7-tetrahydro-1H-purine-6-thiol.
| Compound Name | 2,3,4,7-tetrahydro-1H-purine-6-thiol |
|---|---|
| PubChem CID | 90120156 |
| Molecular Formula | C5H8N4S |
| Molecular Weight | 156.21 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | 2,3,4,7-tetrahydro-1H-purine-6-thiol |
| SMILES | SC1=C2NC=NC2NCN1 |
| InChI | InChI=1S/C5H8N4S/c10-5-3-4(7-1-6-3)8-2-9-5/h1,4,8-10H,2H2,(H,6,7) |
| InChIKey | KIBSFOCEDBGVNT-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.21 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|