C63H57N6O19P — CID 90120498
tris[[3-[(1S,2S)-1-hydroxy-2-methyl-3-nitroso-3-oxo-2-[(4-phenylphenyl)methoxy]propyl]-1,2-oxazol-5-yl]methyl] phosphate (PubChem CID 90120498) has the molecular formula C63H57N6O19P and a molecular weight of 1233.15 g/mol. Its IUPAC name is tris[[3-[(1S,2S)-1-hydroxy-2-methyl-3-nitroso-3-oxo-2-[(4-phenylphenyl)methoxy]propyl]-1,2-oxazol-5-yl]methyl] phosphate.
| Compound Name | tris[[3-[(1S,2S)-1-hydroxy-2-methyl-3-nitroso-3-oxo-2-[(4-phenylphenyl)methoxy]propyl]-1,2-oxazol-5-yl]methyl] phosphate |
|---|---|
| PubChem CID | 90120498 |
| Molecular Formula | C63H57N6O19P |
| Molecular Weight | 1233.15 g/mol |
| Exact Mass | 1232.34 |
| IUPAC Name | tris[[3-[(1S,2S)-1-hydroxy-2-methyl-3-nitroso-3-oxo-2-[(4-phenylphenyl)methoxy]propyl]-1,2-oxazol-5-yl]methyl] phosphate |
| SMILES | C[C@@](OCc1ccc(-c2ccccc2)cc1)(C(=O)N=O)[C@@H](O)c1cc(COP(=O)(OCc2cc([C@H](O)[C@](C)(OCc3ccc(-c4ccccc4)cc3)C(=O)N=O)no2)OCc2cc([C@H](O)[C@](C)(OCc3ccc(-c4ccccc4)cc3)C(=O)N=O)no2)on1 |
| InChI | InChI=1S/C63H57N6O19P/c1-61(58(73)64-76,80-34-40-19-25-46(26-20-40)43-13-7-4-8-14-43)55(70)52-31-49(86-67-52)37-83-89(79,84-38-50-32-53(68-87-50)56(71)62(2,59(74)65-77)81-35-41-21-27-47(28-22-41)44-15-9-5-10-16-44)85-39-51-33-54(69-88-51)57(72)63(3,60(75)66-78)82-36-42-23-29-48(30-24-42)45-17-11-6-12-18-45/h4-33,55-57,70-72H,34-39H2,1-3H3/t55-,56-,57-,61-,62-,63-/m0/s1 |
| InChIKey | KUEKWKYCXVMFOL-FRAJVJQYSA-N |
| XLogP | 11.62 |
| TPSA | 350.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 89 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1233.15 |
| LogP ≤ 5 | 11.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 22 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|