C18H16N3O5- — CID 9012101
4-[(2R)-3-cyclopropyl-4-oxo-1,2-dihydroquinazolin-2-yl]-2-methoxy-6-nitrophenolate (PubChem CID 9012101) has the molecular formula C18H16N3O5- and a molecular weight of 354.34 g/mol. Its IUPAC name is 4-[(2R)-3-cyclopropyl-4-oxo-1,2-dihydroquinazolin-2-yl]-2-methoxy-6-nitrophenolate.
| Compound Name | 4-[(2R)-3-cyclopropyl-4-oxo-1,2-dihydroquinazolin-2-yl]-2-methoxy-6-nitrophenolate |
|---|---|
| PubChem CID | 9012101 |
| Molecular Formula | C18H16N3O5- |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 4-[(2R)-3-cyclopropyl-4-oxo-1,2-dihydroquinazolin-2-yl]-2-methoxy-6-nitrophenolate |
| SMILES | COc1cc([C@@H]2Nc3ccccc3C(=O)N2C2CC2)cc([N+](=O)[O-])c1[O-] |
| InChI | InChI=1S/C18H17N3O5/c1-26-15-9-10(8-14(16(15)22)21(24)25)17-19-13-5-3-2-4-12(13)18(23)20(17)11-6-7-11/h2-5,8-9,11,17,19,22H,6-7H2,1H3/p-1/t17-/m1/s1 |
| InChIKey | UTBOOHJGVUODTP-QGZVFWFLSA-M |
| XLogP | 2.41 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|