C7H4F4O4 — CID 90121094
3-(2,2,3,3-tetrafluoropropoxy)furan-2,5-dione (PubChem CID 90121094) has the molecular formula C7H4F4O4 and a molecular weight of 228.10 g/mol. Its IUPAC name is 3-(2,2,3,3-tetrafluoropropoxy)furan-2,5-dione.
| Compound Name | 3-(2,2,3,3-tetrafluoropropoxy)furan-2,5-dione |
|---|---|
| PubChem CID | 90121094 |
| Molecular Formula | C7H4F4O4 |
| Molecular Weight | 228.10 g/mol |
| Exact Mass | 228.00 |
| IUPAC Name | 3-(2,2,3,3-tetrafluoropropoxy)furan-2,5-dione |
| SMILES | O=C1C=C(OCC(F)(F)C(F)F)C(=O)O1 |
| InChI | InChI=1S/C7H4F4O4/c8-6(9)7(10,11)2-14-3-1-4(12)15-5(3)13/h1,6H,2H2 |
| InChIKey | MQUDWPYVIVEQDF-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.10 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|