C16H18FN7S — CID 90121148
(4aR,7aR)-6-(4-ethyl-5-fluoropyrimidin-2-yl)-7a-pyrazin-2-yl-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-2-amine (PubChem CID 90121148) has the molecular formula C16H18FN7S and a molecular weight of 359.43 g/mol. Its IUPAC name is (4aR,7aR)-6-(4-ethyl-5-fluoropyrimidin-2-yl)-7a-pyrazin-2-yl-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-2-amine.
| Compound Name | (4aR,7aR)-6-(4-ethyl-5-fluoropyrimidin-2-yl)-7a-pyrazin-2-yl-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 90121148 |
| Molecular Formula | C16H18FN7S |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | (4aR,7aR)-6-(4-ethyl-5-fluoropyrimidin-2-yl)-7a-pyrazin-2-yl-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-2-amine |
| SMILES | CCc1nc(N2C[C@H]3CSC(N)=N[C@@]3(c3cnccn3)C2)ncc1F |
| InChI | InChI=1S/C16H18FN7S/c1-2-12-11(17)5-21-15(22-12)24-7-10-8-25-14(18)23-16(10,9-24)13-6-19-3-4-20-13/h3-6,10H,2,7-9H2,1H3,(H2,18,23)/t10-,16-/m0/s1 |
| InChIKey | NANRPJCKPCKXFL-QFYYESIMSA-N |
| XLogP | 1.36 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |