C21H33IO2 — CID 90121424
1-[(3R,5R,7R,10S,13S)-3-hydroxy-7-iodo-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 90121424) has the molecular formula C21H33IO2 and a molecular weight of 444.40 g/mol. Its IUPAC name is 1-[(3R,5R,7R,10S,13S)-3-hydroxy-7-iodo-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 1-[(3R,5R,7R,10S,13S)-3-hydroxy-7-iodo-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 90121424 |
| Molecular Formula | C21H33IO2 |
| Molecular Weight | 444.40 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 1-[(3R,5R,7R,10S,13S)-3-hydroxy-7-iodo-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CC(=O)C1CCC2C3C(I)C[C@H]4C[C@H](O)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C21H33IO2/c1-12(23)15-4-5-16-19-17(7-9-21(15,16)3)20(2)8-6-14(24)10-13(20)11-18(19)22/h13-19,24H,4-11H2,1-3H3/t13-,14-,15?,16?,17?,18?,19?,20+,21-/m1/s1 |
| InChIKey | QUUNHXYXSKJLRW-DECFVGKASA-N |
| XLogP | 5.01 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.40 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|