C23H13F3N2O — CID 90121576
2-methyl-8-[4-(3,4,5-trifluorophenyl)-2-pyridinyl]-[1]benzofuro[2,3-b]pyridine (PubChem CID 90121576) has the molecular formula C23H13F3N2O and a molecular weight of 390.36 g/mol. Its IUPAC name is 2-methyl-8-[4-(3,4,5-trifluorophenyl)-2-pyridinyl]-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 2-methyl-8-[4-(3,4,5-trifluorophenyl)-2-pyridinyl]-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 90121576 |
| Molecular Formula | C23H13F3N2O |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 2-methyl-8-[4-(3,4,5-trifluorophenyl)-2-pyridinyl]-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1ccc2c(n1)oc1c(-c3cc(-c4cc(F)c(F)c(F)c4)ccn3)cccc12 |
| InChI | InChI=1S/C23H13F3N2O/c1-12-5-6-16-15-3-2-4-17(22(15)29-23(16)28-12)20-11-13(7-8-27-20)14-9-18(24)21(26)19(25)10-14/h2-11H,1H3 |
| InChIKey | LCSCDOYGVNPJEE-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|