About 8-[4-(3,4-difluorophenyl)-2-pyridinyl]-2-methyl-[1]benzofuro[2,3-b]pyridine
8-[4-(3,4-difluorophenyl)-2-pyridinyl]-2-methyl-[1]benzofuro[2,3-b]pyridine (PubChem CID 90121615) has the molecular formula C23H14F2N2O
and a molecular weight of 372.37 g/mol. Its IUPAC name is 8-[4-(3,4-difluorophenyl)-2-pyridinyl]-2-methyl-[1]benzofuro[2,3-b]pyridine.
Molecular Properties
| Compound Name | 8-[4-(3,4-difluorophenyl)-2-pyridinyl]-2-methyl-[1]benzofuro[2,3-b]pyridine |
| PubChem CID | 90121615 |
| Molecular Formula | C23H14F2N2O |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 8-[4-(3,4-difluorophenyl)-2-pyridinyl]-2-methyl-[1]benzofuro[2,3-b]pyridine |
| SMILES | Cc1ccc2c(n1)oc1c(-c3cc(-c4ccc(F)c(F)c4)ccn3)cccc12 |
| InChI | InChI=1S/C23H14F2N2O/c1-13-5-7-17-16-3-2-4-18(22(16)28-23(17)27-13)21-12-15(9-10-26-21)14-6-8-19(24)20(25)11-14/h2-12H,1H3 |
| InChIKey | CCAMYHHUPLWYMF-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-[4-(3,4-difluorophenyl)-2-pyridinyl]-2-methyl-[1]benzofuro[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[4-(3,4-difluorophenyl)-2-pyridinyl]-2-methyl-[1]benzofuro[2,3-b]pyridine?
The IUPAC name of 8-[4-(3,4-difluorophenyl)-2-pyridinyl]-2-methyl-[1]benzofuro[2,3-b]pyridine (CID 90121615) is 8-[4-(3,4-difluorophenyl)-2-pyridinyl]-2-methyl-[1]benzofuro[2,3-b]pyridine.
What is the SMILES notation for 8-[4-(3,4-difluorophenyl)-2-pyridinyl]-2-methyl-[1]benzofuro[2,3-b]pyridine?
The canonical SMILES for 8-[4-(3,4-difluorophenyl)-2-pyridinyl]-2-methyl-[1]benzofuro[2,3-b]pyridine is Cc1ccc2c(n1)oc1c(-c3cc(-c4ccc(F)c(F)c4)ccn3)cccc12.
What is the InChIKey of 8-[4-(3,4-difluorophenyl)-2-pyridinyl]-2-methyl-[1]benzofuro[2,3-b]pyridine?
The InChIKey is CCAMYHHUPLWYMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H14F2N2O/c1-13-5-7-17-16-3-2-4-18(22(16)28-23(17)27-13)21-12-15(9-10-26-21)14-6-8-19(24)20(25)11-14/h2-12H,1H3.
What are the key properties of 8-[4-(3,4-difluorophenyl)-2-pyridinyl]-2-methyl-[1]benzofuro[2,3-b]pyridine?
8-[4-(3,4-difluorophenyl)-2-pyridinyl]-2-methyl-[1]benzofuro[2,3-b]pyridine has a molecular weight of 372.37 g/mol, XLogP of 6.30, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[4-(3,4-difluorophenyl)-2-pyridinyl]-2-methyl-[1]benzofuro[2,3-b]pyridine is sourced from PubChem (CID 90121615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).