C21H20N4O3 — CID 90121732
bicyclo[3.1.0]hexa-1(6),2,4-triene;3-ethynyl-8-(6-methyl-3-nitro-2-pyridinyl)-1-oxa-2,8-diazaspiro[4.5]dec-2-ene (PubChem CID 90121732) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is bicyclo[3.1.0]hexa-1(6),2,4-triene;3-ethynyl-8-(6-methyl-3-nitro-2-pyridinyl)-1-oxa-2,8-diazaspiro[4.5]dec-2-ene.
| Compound Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;3-ethynyl-8-(6-methyl-3-nitro-2-pyridinyl)-1-oxa-2,8-diazaspiro[4.5]dec-2-ene |
|---|---|
| PubChem CID | 90121732 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;3-ethynyl-8-(6-methyl-3-nitro-2-pyridinyl)-1-oxa-2,8-diazaspiro[4.5]dec-2-ene |
| SMILES | C#CC1=NOC2(CCN(c3nc(C)ccc3[N+](=O)[O-])CC2)C1.c1cc2cc-2c1 |
| InChI | InChI=1S/C15H16N4O3.C6H4/c1-3-12-10-15(22-17-12)6-8-18(9-7-15)14-13(19(20)21)5-4-11(2)16-14;1-2-5-4-6(5)3-1/h1,4-5H,6-10H2,2H3;1-4H |
| InChIKey | UVLIDLDLGFGUPB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 80.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|