C13H14F2N2O — CID 90121791
5,6-difluoro-2-[(3R,6R)-6-methylpiperidin-3-yl]-1,3-benzoxazole (PubChem CID 90121791) has the molecular formula C13H14F2N2O and a molecular weight of 252.26 g/mol. Its IUPAC name is 5,6-difluoro-2-[(3R,6R)-6-methylpiperidin-3-yl]-1,3-benzoxazole.
| Compound Name | 5,6-difluoro-2-[(3R,6R)-6-methylpiperidin-3-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 90121791 |
| Molecular Formula | C13H14F2N2O |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 5,6-difluoro-2-[(3R,6R)-6-methylpiperidin-3-yl]-1,3-benzoxazole |
| SMILES | C[C@@H]1CC[C@@H](c2nc3cc(F)c(F)cc3o2)CN1 |
| InChI | InChI=1S/C13H14F2N2O/c1-7-2-3-8(6-16-7)13-17-11-4-9(14)10(15)5-12(11)18-13/h4-5,7-8,16H,2-3,6H2,1H3/t7-,8-/m1/s1 |
| InChIKey | YWCUNKCLAGSULG-HTQZYQBOSA-N |
| XLogP | 2.96 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |