About bicyclo[2.2.0]hexa-1,3,5-triene;2-ethynyl-1-oxa-9-azaspiro[5.5]undec-4-ene
bicyclo[2.2.0]hexa-1,3,5-triene;2-ethynyl-1-oxa-9-azaspiro[5.5]undec-4-ene (PubChem CID 90122037) has the molecular formula C17H19NO
and a molecular weight of 253.34 g/mol. Its IUPAC name is bicyclo[2.2.0]hexa-1,3,5-triene;2-ethynyl-1-oxa-9-azaspiro[5.5]undec-4-ene.
Molecular Properties
| Compound Name | bicyclo[2.2.0]hexa-1,3,5-triene;2-ethynyl-1-oxa-9-azaspiro[5.5]undec-4-ene |
| PubChem CID | 90122037 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | bicyclo[2.2.0]hexa-1,3,5-triene;2-ethynyl-1-oxa-9-azaspiro[5.5]undec-4-ene |
| SMILES | C#CC1CC=CC2(CCNCC2)O1.c1cc2ccc1-2 |
| InChI | InChI=1S/C11H15NO.C6H4/c1-2-10-4-3-5-11(13-10)6-8-12-9-7-11;1-2-6-4-3-5(1)6/h1,3,5,10,12H,4,6-9H2;1-4H |
| InChIKey | YVCNWZFYWJSDLW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.0]hexa-1,3,5-triene;2-ethynyl-1-oxa-9-azaspiro[5.5]undec-4-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.0]hexa-1,3,5-triene;2-ethynyl-1-oxa-9-azaspiro[5.5]undec-4-ene?
The IUPAC name of bicyclo[2.2.0]hexa-1,3,5-triene;2-ethynyl-1-oxa-9-azaspiro[5.5]undec-4-ene (CID 90122037) is bicyclo[2.2.0]hexa-1,3,5-triene;2-ethynyl-1-oxa-9-azaspiro[5.5]undec-4-ene.
What is the SMILES notation for bicyclo[2.2.0]hexa-1,3,5-triene;2-ethynyl-1-oxa-9-azaspiro[5.5]undec-4-ene?
The canonical SMILES for bicyclo[2.2.0]hexa-1,3,5-triene;2-ethynyl-1-oxa-9-azaspiro[5.5]undec-4-ene is C#CC1CC=CC2(CCNCC2)O1.c1cc2ccc1-2.
What is the InChIKey of bicyclo[2.2.0]hexa-1,3,5-triene;2-ethynyl-1-oxa-9-azaspiro[5.5]undec-4-ene?
The InChIKey is YVCNWZFYWJSDLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO.C6H4/c1-2-10-4-3-5-11(13-10)6-8-12-9-7-11;1-2-6-4-3-5(1)6/h1,3,5,10,12H,4,6-9H2;1-4H.
What are the key properties of bicyclo[2.2.0]hexa-1,3,5-triene;2-ethynyl-1-oxa-9-azaspiro[5.5]undec-4-ene?
bicyclo[2.2.0]hexa-1,3,5-triene;2-ethynyl-1-oxa-9-azaspiro[5.5]undec-4-ene has a molecular weight of 253.34 g/mol, XLogP of 2.75, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.0]hexa-1,3,5-triene;2-ethynyl-1-oxa-9-azaspiro[5.5]undec-4-ene is sourced from PubChem (CID 90122037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).