C26H34O2S3 — CID 90122405
2-[[2,3,5,6-tetramethyl-4-[2,3,5,6-tetramethyl-4-(oxiran-2-ylmethylsulfanyl)phenyl]sulfanylphenyl]sulfanylmethyl]oxirane (PubChem CID 90122405) has the molecular formula C26H34O2S3 and a molecular weight of 474.76 g/mol. Its IUPAC name is 2-[[2,3,5,6-tetramethyl-4-[2,3,5,6-tetramethyl-4-(oxiran-2-ylmethylsulfanyl)phenyl]sulfanylphenyl]sulfanylmethyl]oxirane.
| Compound Name | 2-[[2,3,5,6-tetramethyl-4-[2,3,5,6-tetramethyl-4-(oxiran-2-ylmethylsulfanyl)phenyl]sulfanylphenyl]sulfanylmethyl]oxirane |
|---|---|
| PubChem CID | 90122405 |
| Molecular Formula | C26H34O2S3 |
| Molecular Weight | 474.76 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 2-[[2,3,5,6-tetramethyl-4-[2,3,5,6-tetramethyl-4-(oxiran-2-ylmethylsulfanyl)phenyl]sulfanylphenyl]sulfanylmethyl]oxirane |
| SMILES | Cc1c(C)c(Sc2c(C)c(C)c(SCC3CO3)c(C)c2C)c(C)c(C)c1SCC1CO1 |
| InChI | InChI=1S/C26H34O2S3/c1-13-17(5)25(18(6)14(2)23(13)29-11-21-9-27-21)31-26-19(7)15(3)24(16(4)20(26)8)30-12-22-10-28-22/h21-22H,9-12H2,1-8H3 |
| InChIKey | WXWAHRSYTCEZDY-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.76 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|