About 1-ethyl-3,6-dimethylpyrazolo[5,4-b]pyridine
1-ethyl-3,6-dimethylpyrazolo[5,4-b]pyridine (PubChem CID 90122617) has the molecular formula C10H13N3
and a molecular weight of 175.23 g/mol. Its IUPAC name is 1-ethyl-3,6-dimethylpyrazolo[5,4-b]pyridine.
Molecular Properties
| Compound Name | 1-ethyl-3,6-dimethylpyrazolo[5,4-b]pyridine |
| PubChem CID | 90122617 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 1-ethyl-3,6-dimethylpyrazolo[5,4-b]pyridine |
| SMILES | CCn1nc(C)c2ccc(C)nc21 |
| InChI | InChI=1S/C10H13N3/c1-4-13-10-9(8(3)12-13)6-5-7(2)11-10/h5-6H,4H2,1-3H3 |
| InChIKey | LXJDNEQSUIRXKA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethyl-3,6-dimethylpyrazolo[5,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3,6-dimethylpyrazolo[5,4-b]pyridine?
The IUPAC name of 1-ethyl-3,6-dimethylpyrazolo[5,4-b]pyridine (CID 90122617) is 1-ethyl-3,6-dimethylpyrazolo[5,4-b]pyridine.
What is the SMILES notation for 1-ethyl-3,6-dimethylpyrazolo[5,4-b]pyridine?
The canonical SMILES for 1-ethyl-3,6-dimethylpyrazolo[5,4-b]pyridine is CCn1nc(C)c2ccc(C)nc21.
What is the InChIKey of 1-ethyl-3,6-dimethylpyrazolo[5,4-b]pyridine?
The InChIKey is LXJDNEQSUIRXKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3/c1-4-13-10-9(8(3)12-13)6-5-7(2)11-10/h5-6H,4H2,1-3H3.
What are the key properties of 1-ethyl-3,6-dimethylpyrazolo[5,4-b]pyridine?
1-ethyl-3,6-dimethylpyrazolo[5,4-b]pyridine has a molecular weight of 175.23 g/mol, XLogP of 2.07, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3,6-dimethylpyrazolo[5,4-b]pyridine is sourced from PubChem (CID 90122617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).