C14H10F12O — CID 90122674
3,4,5,6,6,6-hexafluoro-2-(3,4,5,6,6,6-hexafluoro-5-methylhexa-1,3-dien-2-yl)oxy-5-methylhexa-1,3-diene (PubChem CID 90122674) has the molecular formula C14H10F12O and a molecular weight of 422.21 g/mol. Its IUPAC name is 3,4,5,6,6,6-hexafluoro-2-(3,4,5,6,6,6-hexafluoro-5-methylhexa-1,3-dien-2-yl)oxy-5-methylhexa-1,3-diene.
| Compound Name | 3,4,5,6,6,6-hexafluoro-2-(3,4,5,6,6,6-hexafluoro-5-methylhexa-1,3-dien-2-yl)oxy-5-methylhexa-1,3-diene |
|---|---|
| PubChem CID | 90122674 |
| Molecular Formula | C14H10F12O |
| Molecular Weight | 422.21 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | 3,4,5,6,6,6-hexafluoro-2-(3,4,5,6,6,6-hexafluoro-5-methylhexa-1,3-dien-2-yl)oxy-5-methylhexa-1,3-diene |
| SMILES | C=C(OC(=C)C(F)=C(F)C(C)(F)C(F)(F)F)C(F)=C(F)C(C)(F)C(F)(F)F |
| InChI | InChI=1S/C14H10F12O/c1-5(7(15)9(17)11(3,19)13(21,22)23)27-6(2)8(16)10(18)12(4,20)14(24,25)26/h1-2H2,3-4H3 |
| InChIKey | ADMFKGPEHLCZKR-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.21 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|