C20H22F6N2O — CID 90122678
4-tert-butyl-2-[6-(trifluoromethyl)-3-pyridinyl]-6-[(3,3,3-trifluoropropylamino)methyl]phenol (PubChem CID 90122678) has the molecular formula C20H22F6N2O and a molecular weight of 420.40 g/mol. Its IUPAC name is 4-tert-butyl-2-[6-(trifluoromethyl)-3-pyridinyl]-6-[(3,3,3-trifluoropropylamino)methyl]phenol.
| Compound Name | 4-tert-butyl-2-[6-(trifluoromethyl)-3-pyridinyl]-6-[(3,3,3-trifluoropropylamino)methyl]phenol |
|---|---|
| PubChem CID | 90122678 |
| Molecular Formula | C20H22F6N2O |
| Molecular Weight | 420.40 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 4-tert-butyl-2-[6-(trifluoromethyl)-3-pyridinyl]-6-[(3,3,3-trifluoropropylamino)methyl]phenol |
| SMILES | CC(C)(C)c1cc(CNCCC(F)(F)F)c(O)c(-c2ccc(C(F)(F)F)nc2)c1 |
| InChI | InChI=1S/C20H22F6N2O/c1-18(2,3)14-8-13(10-27-7-6-19(21,22)23)17(29)15(9-14)12-4-5-16(28-11-12)20(24,25)26/h4-5,8-9,11,27,29H,6-7,10H2,1-3H3 |
| InChIKey | VPLXTCPNQKEKLK-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.40 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|