C24H26F2N4O9 — CID 90123366
[(2R,3R,5R)-5-[4-(ethoxycarbonylamino)-2-oxopyrimidin-1-yl]-4,4-difluoro-3-prop-2-enoxycarbonyloxyoxolan-2-yl]methyl 3-pyridin-3-ylpropanoate (PubChem CID 90123366) has the molecular formula C24H26F2N4O9 and a molecular weight of 552.49 g/mol. Its IUPAC name is [(2R,3R,5R)-5-[4-(ethoxycarbonylamino)-2-oxopyrimidin-1-yl]-4,4-difluoro-3-prop-2-enoxycarbonyloxyoxolan-2-yl]methyl 3-pyridin-3-ylpropanoate.
| Compound Name | [(2R,3R,5R)-5-[4-(ethoxycarbonylamino)-2-oxopyrimidin-1-yl]-4,4-difluoro-3-prop-2-enoxycarbonyloxyoxolan-2-yl]methyl 3-pyridin-3-ylpropanoate |
|---|---|
| PubChem CID | 90123366 |
| Molecular Formula | C24H26F2N4O9 |
| Molecular Weight | 552.49 g/mol |
| Exact Mass | 552.17 |
| IUPAC Name | [(2R,3R,5R)-5-[4-(ethoxycarbonylamino)-2-oxopyrimidin-1-yl]-4,4-difluoro-3-prop-2-enoxycarbonyloxyoxolan-2-yl]methyl 3-pyridin-3-ylpropanoate |
| SMILES | C=CCOC(=O)O[C@@H]1[C@@H](COC(=O)CCc2cccnc2)O[C@@H](n2ccc(NC(=O)OCC)nc2=O)C1(F)F |
| InChI | InChI=1S/C24H26F2N4O9/c1-3-12-36-23(34)39-19-16(14-37-18(31)8-7-15-6-5-10-27-13-15)38-20(24(19,25)26)30-11-9-17(28-21(30)32)29-22(33)35-4-2/h3,5-6,9-11,13,16,19-20H,1,4,7-8,12,14H2,2H3,(H,28,29,32,33)/t16-,19-,20-/m1/s1 |
| InChIKey | CCCXTSCADYQFOS-NSISKUIASA-N |
| XLogP | 2.62 |
| TPSA | 157.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.49 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|