C34H50N2O7Si — CID 90123445
tert-butyl 3-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-1H-isoquinoline-2-carbonyl]-4-(1-hydroxy-2-nitrohexyl)benzoate (PubChem CID 90123445) has the molecular formula C34H50N2O7Si and a molecular weight of 626.87 g/mol. Its IUPAC name is tert-butyl 3-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-1H-isoquinoline-2-carbonyl]-4-(1-hydroxy-2-nitrohexyl)benzoate.
| Compound Name | tert-butyl 3-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-1H-isoquinoline-2-carbonyl]-4-(1-hydroxy-2-nitrohexyl)benzoate |
|---|---|
| PubChem CID | 90123445 |
| Molecular Formula | C34H50N2O7Si |
| Molecular Weight | 626.87 g/mol |
| Exact Mass | 626.34 |
| IUPAC Name | tert-butyl 3-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-1H-isoquinoline-2-carbonyl]-4-(1-hydroxy-2-nitrohexyl)benzoate |
| SMILES | CCCCC(C(O)c1ccc(C(=O)OC(C)(C)C)cc1C(=O)N1Cc2ccccc2CC1CO[Si](C)(C)C(C)(C)C)[N+](=O)[O-] |
| InChI | InChI=1S/C34H50N2O7Si/c1-10-11-16-29(36(40)41)30(37)27-18-17-24(32(39)43-33(2,3)4)20-28(27)31(38)35-21-25-15-13-12-14-23(25)19-26(35)22-42-44(8,9)34(5,6)7/h12-15,17-18,20,26,29-30,37H,10-11,16,19,21-22H2,1-9H3 |
| InChIKey | XJHZVGVVAZEVCW-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.87 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|