C29H52O4Si — CID 90123720
[5-[(2S,3R,7R,8S)-6,8-dimethoxy-2-methyl-7-(3-methylbut-2-enyl)-9-oxatricyclo[5.2.1.03,8]dec-5-en-2-yl]-2-methylpentan-2-yl]oxy-triethylsilane (PubChem CID 90123720) has the molecular formula C29H52O4Si and a molecular weight of 492.82 g/mol. Its IUPAC name is [5-[(2S,3R,7R,8S)-6,8-dimethoxy-2-methyl-7-(3-methylbut-2-enyl)-9-oxatricyclo[5.2.1.03,8]dec-5-en-2-yl]-2-methylpentan-2-yl]oxy-triethylsilane.
| Compound Name | [5-[(2S,3R,7R,8S)-6,8-dimethoxy-2-methyl-7-(3-methylbut-2-enyl)-9-oxatricyclo[5.2.1.03,8]dec-5-en-2-yl]-2-methylpentan-2-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 90123720 |
| Molecular Formula | C29H52O4Si |
| Molecular Weight | 492.82 g/mol |
| Exact Mass | 492.36 |
| IUPAC Name | [5-[(2S,3R,7R,8S)-6,8-dimethoxy-2-methyl-7-(3-methylbut-2-enyl)-9-oxatricyclo[5.2.1.03,8]dec-5-en-2-yl]-2-methylpentan-2-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)OC(C)(C)CCC[C@]1(C)C2C[C@]3(CC=C(C)C)C(OC)=CC[C@H]1[C@]3(OC)O2 |
| InChI | InChI=1S/C29H52O4Si/c1-11-34(12-2,13-3)33-26(6,7)18-14-19-27(8)23-15-16-24(30-9)28(20-17-22(4)5)21-25(27)32-29(23,28)31-10/h16-17,23,25H,11-15,18-21H2,1-10H3/t23-,25?,27+,28-,29+/m1/s1 |
| InChIKey | RQNOXJJAHLOCBH-WIEPMZCISA-N |
| XLogP | 8.00 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.82 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|