C16H20O2 — CID 90123925
2,4,6,8-tetramethyl-5,8,10,10a-tetrahydropyrano[3,2-g]chromene (PubChem CID 90123925) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is 2,4,6,8-tetramethyl-5,8,10,10a-tetrahydropyrano[3,2-g]chromene.
| Compound Name | 2,4,6,8-tetramethyl-5,8,10,10a-tetrahydropyrano[3,2-g]chromene |
|---|---|
| PubChem CID | 90123925 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | 2,4,6,8-tetramethyl-5,8,10,10a-tetrahydropyrano[3,2-g]chromene |
| SMILES | CC1=CC(C)=C2CC3=C(CC2O1)OC(C)C=C3C |
| InChI | InChI=1S/C16H20O2/c1-9-5-11(3)17-15-8-16-14(7-13(9)15)10(2)6-12(4)18-16/h5-6,11,16H,7-8H2,1-4H3 |
| InChIKey | PNXYKOHCEPKBLT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |