C11H15ArBF3N3O2 — CID 90123945
argon;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 90123945) has the molecular formula C11H15ArBF3N3O2 and a molecular weight of 329.01 g/mol. Its IUPAC name is argon;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | argon;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 90123945 |
| Molecular Formula | C11H15ArBF3N3O2 |
| Molecular Weight | 329.01 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | argon;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | CC1(C)OB(c2cnc(N)nc2C(F)(F)F)OC1(C)C.[Ar] |
| InChI | InChI=1S/C11H15BF3N3O2.Ar/c1-9(2)10(3,4)20-12(19-9)6-5-17-8(16)18-7(6)11(13,14)15;/h5H,1-4H3,(H2,16,17,18); |
| InChIKey | UKQHBRCGQMRVBV-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.01 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|